C20H35N5OS — CID 111387171
N-[3-[[ethylamino-[3-(4-methylpiperidin-1-yl)propylamino]methylidene]amino]propyl]thiophene-2-carboxamide (PubChem CID 111387171) has the molecular formula C20H35N5OS and a molecular weight of 393.60 g/mol. Its IUPAC name is N-[3-[[ethylamino-[3-(4-methylpiperidin-1-yl)propylamino]methylidene]amino]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[ethylamino-[3-(4-methylpiperidin-1-yl)propylamino]methylidene]amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 111387171 |
| Molecular Formula | C20H35N5OS |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | N-[3-[[ethylamino-[3-(4-methylpiperidin-1-yl)propylamino]methylidene]amino]propyl]thiophene-2-carboxamide |
| SMILES | CCN/C(=N\CCCNC(=O)c1cccs1)NCCCN1CCC(C)CC1 |
| InChI | InChI=1S/C20H35N5OS/c1-3-21-20(24-12-6-13-25-14-8-17(2)9-15-25)23-11-5-10-22-19(26)18-7-4-16-27-18/h4,7,16-17H,3,5-6,8-15H2,1-2H3,(H,22,26)(H2,21,23,24) |
| InChIKey | AZNRFEOZMBTXID-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|