C16H29IN4OS — CID 111130027
N-[3-[[ethylamino-(pentylamino)methylidene]amino]propyl]thiophene-2-carboxamide;hydroiodide (PubChem CID 111130027) has the molecular formula C16H29IN4OS and a molecular weight of 452.41 g/mol. Its IUPAC name is N-[3-[[ethylamino-(pentylamino)methylidene]amino]propyl]thiophene-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[ethylamino-(pentylamino)methylidene]amino]propyl]thiophene-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111130027 |
| Molecular Formula | C16H29IN4OS |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | N-[3-[[ethylamino-(pentylamino)methylidene]amino]propyl]thiophene-2-carboxamide;hydroiodide |
| SMILES | CCCCCN/C(=N/CCCNC(=O)c1cccs1)NCC.I |
| InChI | InChI=1S/C16H28N4OS.HI/c1-3-5-6-10-19-16(17-4-2)20-12-8-11-18-15(21)14-9-7-13-22-14;/h7,9,13H,3-6,8,10-12H2,1-2H3,(H,18,21)(H2,17,19,20);1H |
| InChIKey | QBEPRCDLQXNURQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|