C21H30N4OS — CID 111172591
N-[3-[[ethylamino-(4-phenylbutan-2-ylamino)methylidene]amino]propyl]thiophene-2-carboxamide (PubChem CID 111172591) has the molecular formula C21H30N4OS and a molecular weight of 386.57 g/mol. Its IUPAC name is N-[3-[[ethylamino-(4-phenylbutan-2-ylamino)methylidene]amino]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[ethylamino-(4-phenylbutan-2-ylamino)methylidene]amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 111172591 |
| Molecular Formula | C21H30N4OS |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-[3-[[ethylamino-(4-phenylbutan-2-ylamino)methylidene]amino]propyl]thiophene-2-carboxamide |
| SMILES | CCN/C(=N\CCCNC(=O)c1cccs1)NC(C)CCc1ccccc1 |
| InChI | InChI=1S/C21H30N4OS/c1-3-22-21(25-17(2)12-13-18-9-5-4-6-10-18)24-15-8-14-23-20(26)19-11-7-16-27-19/h4-7,9-11,16-17H,3,8,12-15H2,1-2H3,(H,23,26)(H2,22,24,25) |
| InChIKey | ADFTWJOYIVLBFB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|