C16H28N4O3 — CID 111770954
N-[3-[[ethylamino-(3-methoxypropylamino)methylidene]amino]propyl]-3-methylfuran-2-carboxamide (PubChem CID 111770954) has the molecular formula C16H28N4O3 and a molecular weight of 324.43 g/mol. Its IUPAC name is N-[3-[[ethylamino-(3-methoxypropylamino)methylidene]amino]propyl]-3-methylfuran-2-carboxamide.
| Compound Name | N-[3-[[ethylamino-(3-methoxypropylamino)methylidene]amino]propyl]-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 111770954 |
| Molecular Formula | C16H28N4O3 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | N-[3-[[ethylamino-(3-methoxypropylamino)methylidene]amino]propyl]-3-methylfuran-2-carboxamide |
| SMILES | CCN/C(=N\CCCNC(=O)c1occc1C)NCCCOC |
| InChI | InChI=1S/C16H28N4O3/c1-4-17-16(20-10-6-11-22-3)19-9-5-8-18-15(21)14-13(2)7-12-23-14/h7,12H,4-6,8-11H2,1-3H3,(H,18,21)(H2,17,19,20) |
| InChIKey | ODQIEGKDTJWFLY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|