C21H29FN4O2S — CID 111774744
N-[3-[[N-ethyl-N'-[3-(4-fluorophenyl)sulfanylpropyl]carbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide (PubChem CID 111774744) has the molecular formula C21H29FN4O2S and a molecular weight of 420.55 g/mol. Its IUPAC name is N-[3-[[N-ethyl-N'-[3-(4-fluorophenyl)sulfanylpropyl]carbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide.
| Compound Name | N-[3-[[N-ethyl-N'-[3-(4-fluorophenyl)sulfanylpropyl]carbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 111774744 |
| Molecular Formula | C21H29FN4O2S |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-[3-[[N-ethyl-N'-[3-(4-fluorophenyl)sulfanylpropyl]carbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide |
| SMILES | CCN/C(=N\CCCSc1ccc(F)cc1)NCCCNC(=O)c1occc1C |
| InChI | InChI=1S/C21H29FN4O2S/c1-3-23-21(26-13-5-15-29-18-8-6-17(22)7-9-18)25-12-4-11-24-20(27)19-16(2)10-14-28-19/h6-10,14H,3-5,11-13,15H2,1-2H3,(H,24,27)(H2,23,25,26) |
| InChIKey | HRDHMAXVTBUJKI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|