C22H33N5O2 — CID 111558837
1-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine (PubChem CID 111558837) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine.
| Compound Name | 1-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111558837 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 1-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCN1CCCC1=O)NCCCC(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C22H33N5O2/c1-2-23-22(25-13-7-15-26-14-6-11-20(26)28)24-12-5-10-21(29)27-16-18-8-3-4-9-19(18)17-27/h3-4,8-9H,2,5-7,10-17H2,1H3,(H2,23,24,25) |
| InChIKey | HOOGPYSLVGMORG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|