C19H30BrIN4O — CID 111761216
1-[3-(3-bromophenyl)propyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111761216) has the molecular formula C19H30BrIN4O and a molecular weight of 537.28 g/mol. Its IUPAC name is 1-[3-(3-bromophenyl)propyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(3-bromophenyl)propyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111761216 |
| Molecular Formula | C19H30BrIN4O |
| Molecular Weight | 537.28 g/mol |
| Exact Mass | 536.06 |
| IUPAC Name | 1-[3-(3-bromophenyl)propyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCCC1=O)NCCCc1cccc(Br)c1.I |
| InChI | InChI=1S/C19H29BrN4O.HI/c1-2-21-19(23-12-6-14-24-13-5-10-18(24)25)22-11-4-8-16-7-3-9-17(20)15-16;/h3,7,9,15H,2,4-6,8,10-14H2,1H3,(H2,21,22,23);1H |
| InChIKey | PCRUTQUWQDZQHA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|