C20H30F2N4O — CID 111965729
1-[2-(2,5-difluorophenyl)ethyl]-3-ethyl-2-[3-(2-oxoazepan-1-yl)propyl]guanidine (PubChem CID 111965729) has the molecular formula C20H30F2N4O and a molecular weight of 380.48 g/mol. Its IUPAC name is 1-[2-(2,5-difluorophenyl)ethyl]-3-ethyl-2-[3-(2-oxoazepan-1-yl)propyl]guanidine.
| Compound Name | 1-[2-(2,5-difluorophenyl)ethyl]-3-ethyl-2-[3-(2-oxoazepan-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111965729 |
| Molecular Formula | C20H30F2N4O |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 1-[2-(2,5-difluorophenyl)ethyl]-3-ethyl-2-[3-(2-oxoazepan-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCN1CCCCCC1=O)NCCc1cc(F)ccc1F |
| InChI | InChI=1S/C20H30F2N4O/c1-2-23-20(25-12-10-16-15-17(21)8-9-18(16)22)24-11-6-14-26-13-5-3-4-7-19(26)27/h8-9,15H,2-7,10-14H2,1H3,(H2,23,24,25) |
| InChIKey | YXTSZPSHBNOLJS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|