C18H26F2N4O — CID 111566733
1-[2-(2,3-difluorophenyl)ethyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine (PubChem CID 111566733) has the molecular formula C18H26F2N4O and a molecular weight of 352.43 g/mol. Its IUPAC name is 1-[2-(2,3-difluorophenyl)ethyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine.
| Compound Name | 1-[2-(2,3-difluorophenyl)ethyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111566733 |
| Molecular Formula | C18H26F2N4O |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 1-[2-(2,3-difluorophenyl)ethyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCN1CCCC1=O)NCCc1cccc(F)c1F |
| InChI | InChI=1S/C18H26F2N4O/c1-2-21-18(22-10-5-13-24-12-4-8-16(24)25)23-11-9-14-6-3-7-15(19)17(14)20/h3,6-7H,2,4-5,8-13H2,1H3,(H2,21,22,23) |
| InChIKey | YDHUSOIGVKEYGZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|