C18H26FN5O2 — CID 111147672
2-[[ethylamino-[3-(2-oxopyrrolidin-1-yl)propylamino]methylidene]amino]-N-(3-fluorophenyl)acetamide (PubChem CID 111147672) has the molecular formula C18H26FN5O2 and a molecular weight of 363.44 g/mol. Its IUPAC name is 2-[[ethylamino-[3-(2-oxopyrrolidin-1-yl)propylamino]methylidene]amino]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[[ethylamino-[3-(2-oxopyrrolidin-1-yl)propylamino]methylidene]amino]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 111147672 |
| Molecular Formula | C18H26FN5O2 |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 2-[[ethylamino-[3-(2-oxopyrrolidin-1-yl)propylamino]methylidene]amino]-N-(3-fluorophenyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1cccc(F)c1)NCCCN1CCCC1=O |
| InChI | InChI=1S/C18H26FN5O2/c1-2-20-18(21-9-5-11-24-10-4-8-17(24)26)22-13-16(25)23-15-7-3-6-14(19)12-15/h3,6-7,12H,2,4-5,8-11,13H2,1H3,(H,23,25)(H2,20,21,22) |
| InChIKey | RTKJNYAADAOSDN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|