C22H28FN5O2 — CID 111147081
1-ethyl-2-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine (PubChem CID 111147081) has the molecular formula C22H28FN5O2 and a molecular weight of 413.50 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine.
| Compound Name | 1-ethyl-2-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111147081 |
| Molecular Formula | C22H28FN5O2 |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 1-ethyl-2-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccnc1Oc1cccc(F)c1)NCCCN1CCCC1=O |
| InChI | InChI=1S/C22H28FN5O2/c1-2-24-22(26-12-6-14-28-13-5-10-20(28)29)27-16-17-7-4-11-25-21(17)30-19-9-3-8-18(23)15-19/h3-4,7-9,11,15H,2,5-6,10,12-14,16H2,1H3,(H2,24,26,27) |
| InChIKey | ALFFSXJWGZJWJH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|