C24H33FIN5O2 — CID 111347631
1-ethyl-2-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[3-(2-oxoazepan-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111347631) has the molecular formula C24H33FIN5O2 and a molecular weight of 569.46 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[3-(2-oxoazepan-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[3-(2-oxoazepan-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111347631 |
| Molecular Formula | C24H33FIN5O2 |
| Molecular Weight | 569.46 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | 1-ethyl-2-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-[3-(2-oxoazepan-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1Oc1cccc(F)c1)NCCCN1CCCCCC1=O.I |
| InChI | InChI=1S/C24H32FN5O2.HI/c1-2-26-24(28-14-8-16-30-15-5-3-4-12-22(30)31)29-18-19-9-7-13-27-23(19)32-21-11-6-10-20(25)17-21;/h6-7,9-11,13,17H,2-5,8,12,14-16,18H2,1H3,(H2,26,28,29);1H |
| InChIKey | GQKIYLVUDZALIO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|