C23H29FN6O — CID 111280693
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]guanidine (PubChem CID 111280693) has the molecular formula C23H29FN6O and a molecular weight of 424.52 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111280693 |
| Molecular Formula | C23H29FN6O |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[2-(3-fluorophenoxy)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccnc1Oc1cccc(F)c1)NCCCn1nc(C)cc1C |
| InChI | InChI=1S/C23H29FN6O/c1-4-25-23(27-12-7-13-30-18(3)14-17(2)29-30)28-16-19-8-6-11-26-22(19)31-21-10-5-9-20(24)15-21/h5-6,8-11,14-15H,4,7,12-13,16H2,1-3H3,(H2,25,27,28) |
| InChIKey | CMKSXGWPYIJJIZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|