C19H30IN5 — CID 111278656
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[(2-methylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111278656) has the molecular formula C19H30IN5 and a molecular weight of 455.39 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[(2-methylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[(2-methylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111278656 |
| Molecular Formula | C19H30IN5 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[(2-methylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1C)NCCCn1nc(C)cc1C.I |
| InChI | InChI=1S/C19H29N5.HI/c1-5-20-19(22-14-18-10-7-6-9-15(18)2)21-11-8-12-24-17(4)13-16(3)23-24;/h6-7,9-10,13H,5,8,11-12,14H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | WXIDQHAHOGBBSM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|