C22H37IN6O2S — CID 111278234
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111278234) has the molecular formula C22H37IN6O2S and a molecular weight of 576.55 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111278234 |
| Molecular Formula | C22H37IN6O2S |
| Molecular Weight | 576.55 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1CS(=O)(=O)NC(C)C)NCCCn1nc(C)cc1C.I |
| InChI | InChI=1S/C22H36N6O2S.HI/c1-6-23-22(24-12-9-13-28-19(5)14-18(4)26-28)25-15-20-10-7-8-11-21(20)16-31(29,30)27-17(2)3;/h7-8,10-11,14,17,27H,6,9,12-13,15-16H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | IQHDYIZXFBOWPE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|