C18H26FN5 — CID 111266927
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[(2-fluorophenyl)methyl]guanidine (PubChem CID 111266927) has the molecular formula C18H26FN5 and a molecular weight of 331.44 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[(2-fluorophenyl)methyl]guanidine.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[(2-fluorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111266927 |
| Molecular Formula | C18H26FN5 |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[(2-fluorophenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1F)NCCCn1nc(C)cc1C |
| InChI | InChI=1S/C18H26FN5/c1-4-20-18(22-13-16-8-5-6-9-17(16)19)21-10-7-11-24-15(3)12-14(2)23-24/h5-6,8-9,12H,4,7,10-11,13H2,1-3H3,(H2,20,21,22) |
| InChIKey | DMCAXGFXKJUJFP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|