C22H30IN5 — CID 111278378
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-(naphthalen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111278378) has the molecular formula C22H30IN5 and a molecular weight of 491.42 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-(naphthalen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-(naphthalen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111278378 |
| Molecular Formula | C22H30IN5 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-(naphthalen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc2ccccc2c1)NCCCn1nc(C)cc1C.I |
| InChI | InChI=1S/C22H29N5.HI/c1-4-23-22(24-12-7-13-27-18(3)14-17(2)26-27)25-16-19-10-11-20-8-5-6-9-21(20)15-19;/h5-6,8-11,14-15H,4,7,12-13,16H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | LEWVTMAMSXSUOO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|