C21H30IN7 — CID 111279936
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111279936) has the molecular formula C21H30IN7 and a molecular weight of 507.42 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111279936 |
| Molecular Formula | C21H30IN7 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2cccn2)cc1)NCCCn1nc(C)cc1C.I |
| InChI | InChI=1S/C21H29N7.HI/c1-4-22-21(23-11-5-13-27-18(3)15-17(2)26-27)24-16-19-7-9-20(10-8-19)28-14-6-12-25-28;/h6-10,12,14-15H,4-5,11,13,16H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | BHFRKPFQXMTOHE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|