C20H32N6O2S — CID 111279191
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[[4-(dimethylsulfamoyl)phenyl]methyl]-3-ethylguanidine (PubChem CID 111279191) has the molecular formula C20H32N6O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[[4-(dimethylsulfamoyl)phenyl]methyl]-3-ethylguanidine.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[[4-(dimethylsulfamoyl)phenyl]methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111279191 |
| Molecular Formula | C20H32N6O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-[[4-(dimethylsulfamoyl)phenyl]methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N(C)C)cc1)NCCCn1nc(C)cc1C |
| InChI | InChI=1S/C20H32N6O2S/c1-6-21-20(22-12-7-13-26-17(3)14-16(2)24-26)23-15-18-8-10-19(11-9-18)29(27,28)25(4)5/h8-11,14H,6-7,12-13,15H2,1-5H3,(H2,21,22,23) |
| InChIKey | FHUSLTSGWXQTPZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|