C22H36N6O2S — CID 111277891
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine (PubChem CID 111277891) has the molecular formula C22H36N6O2S and a molecular weight of 448.64 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111277891 |
| Molecular Formula | C22H36N6O2S |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[4-[methyl(propan-2-yl)sulfamoyl]phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N(C)C(C)C)cc1)NCCCn1nc(C)cc1C |
| InChI | InChI=1S/C22H36N6O2S/c1-7-23-22(24-13-8-14-28-19(5)15-18(4)26-28)25-16-20-9-11-21(12-10-20)31(29,30)27(6)17(2)3/h9-12,15,17H,7-8,13-14,16H2,1-6H3,(H2,23,24,25) |
| InChIKey | FBGGOUFBEFWXFM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|