C23H33N7 — CID 111774584
2-[[2-(dimethylamino)quinolin-4-yl]methyl]-1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine (PubChem CID 111774584) has the molecular formula C23H33N7 and a molecular weight of 407.57 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)quinolin-4-yl]methyl]-1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine.
| Compound Name | 2-[[2-(dimethylamino)quinolin-4-yl]methyl]-1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111774584 |
| Molecular Formula | C23H33N7 |
| Molecular Weight | 407.57 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | 2-[[2-(dimethylamino)quinolin-4-yl]methyl]-1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cc(N(C)C)nc2ccccc12)NCCCn1nc(C)cc1C |
| InChI | InChI=1S/C23H33N7/c1-6-24-23(25-12-9-13-30-18(3)14-17(2)28-30)26-16-19-15-22(29(4)5)27-21-11-8-7-10-20(19)21/h7-8,10-11,14-15H,6,9,12-13,16H2,1-5H3,(H2,24,25,26) |
| InChIKey | UDWORFIAJXSIIF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|