C19H31IN6O2S — CID 111280450
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[2-(methanesulfonamido)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111280450) has the molecular formula C19H31IN6O2S and a molecular weight of 534.47 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[2-(methanesulfonamido)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[2-(methanesulfonamido)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111280450 |
| Molecular Formula | C19H31IN6O2S |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethyl-2-[[2-(methanesulfonamido)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1NS(C)(=O)=O)NCCCn1nc(C)cc1C.I |
| InChI | InChI=1S/C19H30N6O2S.HI/c1-5-20-19(21-11-8-12-25-16(3)13-15(2)23-25)22-14-17-9-6-7-10-18(17)24-28(4,26)27;/h6-7,9-10,13,24H,5,8,11-12,14H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | PQDIKVJTFWIOEC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|