C18H25F4IN4O — CID 111147496
1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111147496) has the molecular formula C18H25F4IN4O and a molecular weight of 516.32 g/mol. Its IUPAC name is 1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111147496 |
| Molecular Formula | C18H25F4IN4O |
| Molecular Weight | 516.32 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1C(F)(F)F)NCCCN1CCCC1=O.I |
| InChI | InChI=1S/C18H24F4N4O.HI/c1-2-23-17(24-8-4-10-26-9-3-5-16(26)27)25-12-13-6-7-14(19)11-15(13)18(20,21)22;/h6-7,11H,2-5,8-10,12H2,1H3,(H2,23,24,25);1H |
| InChIKey | JZJWDTQAHBNXIO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|