C19H32FIN4O3 — CID 111693569
2-[[[2-(2-butoxyethoxy)ethylamino]-(ethylamino)methylidene]amino]-N-(3-fluorophenyl)acetamide;hydroiodide (PubChem CID 111693569) has the molecular formula C19H32FIN4O3 and a molecular weight of 510.39 g/mol. Its IUPAC name is 2-[[[2-(2-butoxyethoxy)ethylamino]-(ethylamino)methylidene]amino]-N-(3-fluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[[2-(2-butoxyethoxy)ethylamino]-(ethylamino)methylidene]amino]-N-(3-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111693569 |
| Molecular Formula | C19H32FIN4O3 |
| Molecular Weight | 510.39 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | 2-[[[2-(2-butoxyethoxy)ethylamino]-(ethylamino)methylidene]amino]-N-(3-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCCCOCCOCCN/C(=N/CC(=O)Nc1cccc(F)c1)NCC.I |
| InChI | InChI=1S/C19H31FN4O3.HI/c1-3-5-10-26-12-13-27-11-9-22-19(21-4-2)23-15-18(25)24-17-8-6-7-16(20)14-17;/h6-8,14H,3-5,9-13,15H2,1-2H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | YCEJIFCHRVUFDD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|