C20H42IN5O2 — CID 111717919
1-[3-[[[(3-ethoxy-4-methylpentyl)amino]-(ethylamino)methylidene]amino]propyl]piperidine-3-carboxamide;hydroiodide (PubChem CID 111717919) has the molecular formula C20H42IN5O2 and a molecular weight of 511.49 g/mol. Its IUPAC name is 1-[3-[[[(3-ethoxy-4-methylpentyl)amino]-(ethylamino)methylidene]amino]propyl]piperidine-3-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[[(3-ethoxy-4-methylpentyl)amino]-(ethylamino)methylidene]amino]propyl]piperidine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111717919 |
| Molecular Formula | C20H42IN5O2 |
| Molecular Weight | 511.49 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 1-[3-[[[(3-ethoxy-4-methylpentyl)amino]-(ethylamino)methylidene]amino]propyl]piperidine-3-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCCC(C(N)=O)C1)NCCC(OCC)C(C)C.I |
| InChI | InChI=1S/C20H41N5O2.HI/c1-5-22-20(24-12-10-18(16(3)4)27-6-2)23-11-8-14-25-13-7-9-17(15-25)19(21)26;/h16-18H,5-15H2,1-4H3,(H2,21,26)(H2,22,23,24);1H |
| InChIKey | QLMQNBKJNVPFJO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|