C21H35N5OS — CID 111677012
1-[3-[[N-ethyl-N'-(2-phenylsulfanylpropyl)carbamimidoyl]amino]propyl]piperidine-3-carboxamide (PubChem CID 111677012) has the molecular formula C21H35N5OS and a molecular weight of 405.61 g/mol. Its IUPAC name is 1-[3-[[N-ethyl-N'-(2-phenylsulfanylpropyl)carbamimidoyl]amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[N-ethyl-N'-(2-phenylsulfanylpropyl)carbamimidoyl]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 111677012 |
| Molecular Formula | C21H35N5OS |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | 1-[3-[[N-ethyl-N'-(2-phenylsulfanylpropyl)carbamimidoyl]amino]propyl]piperidine-3-carboxamide |
| SMILES | CCN/C(=N\CC(C)Sc1ccccc1)NCCCN1CCCC(C(N)=O)C1 |
| InChI | InChI=1S/C21H35N5OS/c1-3-23-21(25-15-17(2)28-19-10-5-4-6-11-19)24-12-8-14-26-13-7-9-18(16-26)20(22)27/h4-6,10-11,17-18H,3,7-9,12-16H2,1-2H3,(H2,22,27)(H2,23,24,25) |
| InChIKey | NNWTYXKYNDHLHZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|