C24H32N4OS — CID 111982753
1-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-3-ethyl-2-(2-phenylsulfanylpropyl)guanidine (PubChem CID 111982753) has the molecular formula C24H32N4OS and a molecular weight of 424.61 g/mol. Its IUPAC name is 1-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-3-ethyl-2-(2-phenylsulfanylpropyl)guanidine.
| Compound Name | 1-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-3-ethyl-2-(2-phenylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 111982753 |
| Molecular Formula | C24H32N4OS |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 1-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-3-ethyl-2-(2-phenylsulfanylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)Sc1ccccc1)NCCCC(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C24H32N4OS/c1-3-25-24(27-16-19(2)30-22-12-5-4-6-13-22)26-15-9-14-23(29)28-17-20-10-7-8-11-21(20)18-28/h4-8,10-13,19H,3,9,14-18H2,1-2H3,(H2,25,26,27) |
| InChIKey | DXCSSINBRUMQED-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|