C19H30N4OS — CID 111677534
N-cyclopropyl-4-[[N-ethyl-N'-(2-phenylsulfanylpropyl)carbamimidoyl]amino]butanamide (PubChem CID 111677534) has the molecular formula C19H30N4OS and a molecular weight of 362.54 g/mol. Its IUPAC name is N-cyclopropyl-4-[[N-ethyl-N'-(2-phenylsulfanylpropyl)carbamimidoyl]amino]butanamide.
| Compound Name | N-cyclopropyl-4-[[N-ethyl-N'-(2-phenylsulfanylpropyl)carbamimidoyl]amino]butanamide |
|---|---|
| PubChem CID | 111677534 |
| Molecular Formula | C19H30N4OS |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | N-cyclopropyl-4-[[N-ethyl-N'-(2-phenylsulfanylpropyl)carbamimidoyl]amino]butanamide |
| SMILES | CCN/C(=N\CC(C)Sc1ccccc1)NCCCC(=O)NC1CC1 |
| InChI | InChI=1S/C19H30N4OS/c1-3-20-19(21-13-7-10-18(24)23-16-11-12-16)22-14-15(2)25-17-8-5-4-6-9-17/h4-6,8-9,15-16H,3,7,10-14H2,1-2H3,(H,23,24)(H2,20,21,22) |
| InChIKey | SWAAQXDDZNEGPZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|