C21H32F3N5O2 — CID 111871637
1-[3-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide (PubChem CID 111871637) has the molecular formula C21H32F3N5O2 and a molecular weight of 443.51 g/mol. Its IUPAC name is 1-[3-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 111871637 |
| Molecular Formula | C21H32F3N5O2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 1-[3-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)cc1)NCCCN1CCCC(C(N)=O)C1 |
| InChI | InChI=1S/C21H32F3N5O2/c1-2-26-20(27-10-4-12-29-11-3-5-17(14-29)19(25)30)28-13-16-6-8-18(9-7-16)31-15-21(22,23)24/h6-9,17H,2-5,10-15H2,1H3,(H2,25,30)(H2,26,27,28) |
| InChIKey | LXKROOPSWQFTAH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|