C14H21F3N4O3S — CID 111872073
1-ethyl-3-(2-sulfamoylethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine (PubChem CID 111872073) has the molecular formula C14H21F3N4O3S and a molecular weight of 382.41 g/mol. Its IUPAC name is 1-ethyl-3-(2-sulfamoylethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-sulfamoylethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111872073 |
| Molecular Formula | C14H21F3N4O3S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 1-ethyl-3-(2-sulfamoylethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)cc1)NCCS(N)(=O)=O |
| InChI | InChI=1S/C14H21F3N4O3S/c1-2-19-13(20-7-8-25(18,22)23)21-9-11-3-5-12(6-4-11)24-10-14(15,16)17/h3-6H,2,7-10H2,1H3,(H2,18,22,23)(H2,19,20,21) |
| InChIKey | LCIKCNODSXILBQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|