C18H27F3N4O2 — CID 111871351
3-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]-N-propylpropanamide (PubChem CID 111871351) has the molecular formula C18H27F3N4O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]-N-propylpropanamide.
| Compound Name | 3-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 111871351 |
| Molecular Formula | C18H27F3N4O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 3-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCN/C(=N/Cc1ccc(OCC(F)(F)F)cc1)NCC |
| InChI | InChI=1S/C18H27F3N4O2/c1-3-10-23-16(26)9-11-24-17(22-4-2)25-12-14-5-7-15(8-6-14)27-13-18(19,20)21/h5-8H,3-4,9-13H2,1-2H3,(H,23,26)(H2,22,24,25) |
| InChIKey | PITZTPAFUIMRGH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|