C14H22F3IN4O3S — CID 111872072
1-ethyl-3-(2-sulfamoylethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111872072) has the molecular formula C14H22F3IN4O3S and a molecular weight of 510.32 g/mol. Its IUPAC name is 1-ethyl-3-(2-sulfamoylethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-sulfamoylethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111872072 |
| Molecular Formula | C14H22F3IN4O3S |
| Molecular Weight | 510.32 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | 1-ethyl-3-(2-sulfamoylethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)cc1)NCCS(N)(=O)=O.I |
| InChI | InChI=1S/C14H21F3N4O3S.HI/c1-2-19-13(20-7-8-25(18,22)23)21-9-11-3-5-12(6-4-11)24-10-14(15,16)17;/h3-6H,2,7-10H2,1H3,(H2,18,22,23)(H2,19,20,21);1H |
| InChIKey | KQHOAEGYHLISOR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|