C17H24F3N3O — CID 111587757
1-ethyl-3-[(E)-pent-3-enyl]-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine (PubChem CID 111587757) has the molecular formula C17H24F3N3O and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-ethyl-3-[(E)-pent-3-enyl]-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[(E)-pent-3-enyl]-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111587757 |
| Molecular Formula | C17H24F3N3O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-ethyl-3-[(E)-pent-3-enyl]-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
| SMILES | C/C=C/CCN/C(=N/Cc1ccc(OCC(F)(F)F)cc1)NCC |
| InChI | InChI=1S/C17H24F3N3O/c1-3-5-6-11-22-16(21-4-2)23-12-14-7-9-15(10-8-14)24-13-17(18,19)20/h3,5,7-10H,4,6,11-13H2,1-2H3,(H2,21,22,23)/b5-3+ |
| InChIKey | ZNLKQIJWDAPQSS-HWKANZROSA-N |
| XLogP | 3.65 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|