C18H31N5OS — CID 111898407
1-[3-[[N-ethyl-N'-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide (PubChem CID 111898407) has the molecular formula C18H31N5OS and a molecular weight of 365.55 g/mol. Its IUPAC name is 1-[3-[[N-ethyl-N'-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[N-ethyl-N'-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 111898407 |
| Molecular Formula | C18H31N5OS |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 1-[3-[[N-ethyl-N'-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide |
| SMILES | CCN/C(=N\Cc1ccc(C)s1)NCCCN1CCCC(C(N)=O)C1 |
| InChI | InChI=1S/C18H31N5OS/c1-3-20-18(22-12-16-8-7-14(2)25-16)21-9-5-11-23-10-4-6-15(13-23)17(19)24/h7-8,15H,3-6,9-13H2,1-2H3,(H2,19,24)(H2,20,21,22) |
| InChIKey | LUQIDXUAIULPOW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|