C22H36IN5OS — CID 111557433
1-[3-[[N-ethyl-N'-[(1-phenylsulfanylcyclopropyl)methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide;hydroiodide (PubChem CID 111557433) has the molecular formula C22H36IN5OS and a molecular weight of 545.54 g/mol. Its IUPAC name is 1-[3-[[N-ethyl-N'-[(1-phenylsulfanylcyclopropyl)methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[N-ethyl-N'-[(1-phenylsulfanylcyclopropyl)methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111557433 |
| Molecular Formula | C22H36IN5OS |
| Molecular Weight | 545.54 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 1-[3-[[N-ethyl-N'-[(1-phenylsulfanylcyclopropyl)methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC1(Sc2ccccc2)CC1)NCCCN1CCCC(C(N)=O)C1.I |
| InChI | InChI=1S/C22H35N5OS.HI/c1-2-24-21(25-13-7-15-27-14-6-8-18(16-27)20(23)28)26-17-22(11-12-22)29-19-9-4-3-5-10-19;/h3-5,9-10,18H,2,6-8,11-17H2,1H3,(H2,23,28)(H2,24,25,26);1H |
| InChIKey | VGIHHPLMOCEKCG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|