C20H30F3N5O2 — CID 111847555
1-[3-[[N-ethyl-N'-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide (PubChem CID 111847555) has the molecular formula C20H30F3N5O2 and a molecular weight of 429.49 g/mol. Its IUPAC name is 1-[3-[[N-ethyl-N'-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[N-ethyl-N'-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 111847555 |
| Molecular Formula | C20H30F3N5O2 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 1-[3-[[N-ethyl-N'-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]propyl]piperidine-3-carboxamide |
| SMILES | CCN/C(=N\Cc1ccccc1OC(F)(F)F)NCCCN1CCCC(C(N)=O)C1 |
| InChI | InChI=1S/C20H30F3N5O2/c1-2-25-19(26-10-6-12-28-11-5-8-16(14-28)18(24)29)27-13-15-7-3-4-9-17(15)30-20(21,22)23/h3-4,7,9,16H,2,5-6,8,10-14H2,1H3,(H2,24,29)(H2,25,26,27) |
| InChIKey | CFDUBSNVXHCVKK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|