C21H30F3IN6O — CID 111848136
1-ethyl-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111848136) has the molecular formula C21H30F3IN6O and a molecular weight of 566.41 g/mol. Its IUPAC name is 1-ethyl-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111848136 |
| Molecular Formula | C21H30F3IN6O |
| Molecular Weight | 566.41 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | 1-ethyl-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1OC(F)(F)F)NCCCc1nnc2n1CCCCC2.I |
| InChI | InChI=1S/C21H29F3N6O.HI/c1-2-25-20(27-15-16-9-5-6-10-17(16)31-21(22,23)24)26-13-8-12-19-29-28-18-11-4-3-7-14-30(18)19;/h5-6,9-10H,2-4,7-8,11-15H2,1H3,(H2,25,26,27);1H |
| InChIKey | KUPBTPFYWQVQLL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|