C21H31FN6 — CID 111361927
1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine (PubChem CID 111361927) has the molecular formula C21H31FN6 and a molecular weight of 386.52 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111361927 |
| Molecular Formula | C21H31FN6 |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCc1nnc2n1CCCCC2)NCCc1ccccc1F |
| InChI | InChI=1S/C21H31FN6/c1-2-23-21(25-15-13-17-9-5-6-10-18(17)22)24-14-8-12-20-27-26-19-11-4-3-7-16-28(19)20/h5-6,9-10H,2-4,7-8,11-16H2,1H3,(H2,23,24,25) |
| InChIKey | QOLJTTZMPVWESD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|