C22H40N6 — CID 111608858
1-(4-cyclopentylbutyl)-3-ethyl-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine (PubChem CID 111608858) has the molecular formula C22H40N6 and a molecular weight of 388.60 g/mol. Its IUPAC name is 1-(4-cyclopentylbutyl)-3-ethyl-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine.
| Compound Name | 1-(4-cyclopentylbutyl)-3-ethyl-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111608858 |
| Molecular Formula | C22H40N6 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | 1-(4-cyclopentylbutyl)-3-ethyl-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCc1nnc2n1CCCCC2)NCCCCC1CCCC1 |
| InChI | InChI=1S/C22H40N6/c1-2-23-22(24-16-8-7-13-19-11-5-6-12-19)25-17-10-15-21-27-26-20-14-4-3-9-18-28(20)21/h19H,2-18H2,1H3,(H2,23,24,25) |
| InChIKey | ZEFPMRGIBVMATO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|