C20H28F3IN6O2 — CID 111848086
1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111848086) has the molecular formula C20H28F3IN6O2 and a molecular weight of 568.38 g/mol. Its IUPAC name is 1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111848086 |
| Molecular Formula | C20H28F3IN6O2 |
| Molecular Weight | 568.38 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | 1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-[[2-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1OC(F)(F)F)NCCCn1nc2n(c1=O)CCCC2.I |
| InChI | InChI=1S/C20H27F3N6O2.HI/c1-2-24-18(26-14-15-8-3-4-9-16(15)31-20(21,22)23)25-11-7-13-29-19(30)28-12-6-5-10-17(28)27-29;/h3-4,8-9H,2,5-7,10-14H2,1H3,(H2,24,25,26);1H |
| InChIKey | OTYYXHSSPWSJPV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|