C21H33IN6O3 — CID 111879370
2-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide (PubChem CID 111879370) has the molecular formula C21H33IN6O3 and a molecular weight of 544.44 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111879370 |
| Molecular Formula | C21H33IN6O3 |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)cc1OC)NCCCn1nc2n(c1=O)CCCC2.I |
| InChI | InChI=1S/C21H32N6O3.HI/c1-4-22-20(24-15-16-9-10-17(29-2)14-18(16)30-3)23-11-7-13-27-21(28)26-12-6-5-8-19(26)25-27;/h9-10,14H,4-8,11-13,15H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | JMOKQEDCLVBSDV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|