C21H32N6O3 — CID 111201482
2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine (PubChem CID 111201482) has the molecular formula C21H32N6O3 and a molecular weight of 416.53 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111201482 |
| Molecular Formula | C21H32N6O3 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1)NCCCn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C21H32N6O3/c1-4-22-20(24-15-16-9-10-17(29-2)18(14-16)30-3)23-11-7-13-27-21(28)26-12-6-5-8-19(26)25-27/h9-10,14H,4-8,11-13,15H2,1-3H3,(H2,22,23,24) |
| InChIKey | DWRMTFOAYOEQRV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|