C19H30N6OS — CID 111703512
1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-(2-thiophen-3-ylpropyl)guanidine (PubChem CID 111703512) has the molecular formula C19H30N6OS and a molecular weight of 390.56 g/mol. Its IUPAC name is 1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-(2-thiophen-3-ylpropyl)guanidine.
| Compound Name | 1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-(2-thiophen-3-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111703512 |
| Molecular Formula | C19H30N6OS |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-(2-thiophen-3-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)c1ccsc1)NCCCn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C19H30N6OS/c1-3-20-18(22-13-15(2)16-8-12-27-14-16)21-9-6-11-25-19(26)24-10-5-4-7-17(24)23-25/h8,12,14-15H,3-7,9-11,13H2,1-2H3,(H2,20,21,22) |
| InChIKey | CSDOTSOMQFISID-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|