C19H31IN6O2S — CID 109420101
1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide (PubChem CID 109420101) has the molecular formula C19H31IN6O2S and a molecular weight of 534.47 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109420101 |
| Molecular Formula | C19H31IN6O2S |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCCn1nc2n(c1=O)CCCC2.I |
| InChI | InChI=1S/C19H30N6O2S.HI/c1-3-20-17(22-14-19(2,27)15-8-6-13-28-15)21-10-7-12-25-18(26)24-11-5-4-9-16(24)23-25;/h6,8,13,27H,3-5,7,9-12,14H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | URNFOIZXQQIVQY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|