C20H27F3N6O — CID 111267685
1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111267685) has the molecular formula C20H27F3N6O and a molecular weight of 424.47 g/mol. Its IUPAC name is 1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111267685 |
| Molecular Formula | C20H27F3N6O |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-ethyl-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCCCn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C20H27F3N6O/c1-2-24-18(26-14-15-7-5-8-16(13-15)20(21,22)23)25-10-6-12-29-19(30)28-11-4-3-9-17(28)27-29/h5,7-8,13H,2-4,6,9-12,14H2,1H3,(H2,24,25,26) |
| InChIKey | NTWZKOCEEJNDIF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|