C22H33N7O2 — CID 111874411
4-[[[ethylamino-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide (PubChem CID 111874411) has the molecular formula C22H33N7O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 4-[[[ethylamino-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[[ethylamino-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111874411 |
| Molecular Formula | C22H33N7O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | 4-[[[ethylamino-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(C)C)cc1)NCCCn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C22H33N7O2/c1-4-23-21(25-16-17-9-11-18(12-10-17)20(30)27(2)3)24-13-7-15-29-22(31)28-14-6-5-8-19(28)26-29/h9-12H,4-8,13-16H2,1-3H3,(H2,23,24,25) |
| InChIKey | KRVIVBJUZKZKIK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|