C19H35N7O2 — CID 111942035
N,N-diethyl-3-[[N-ethyl-N'-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]carbamimidoyl]amino]propanamide (PubChem CID 111942035) has the molecular formula C19H35N7O2 and a molecular weight of 393.54 g/mol. Its IUPAC name is N,N-diethyl-3-[[N-ethyl-N'-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]carbamimidoyl]amino]propanamide.
| Compound Name | N,N-diethyl-3-[[N-ethyl-N'-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111942035 |
| Molecular Formula | C19H35N7O2 |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | N,N-diethyl-3-[[N-ethyl-N'-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]carbamimidoyl]amino]propanamide |
| SMILES | CCN/C(=N\CCCn1nc2n(c1=O)CCCC2)NCCC(=O)N(CC)CC |
| InChI | InChI=1S/C19H35N7O2/c1-4-20-18(22-13-11-17(27)24(5-2)6-3)21-12-9-15-26-19(28)25-14-8-7-10-16(25)23-26/h4-15H2,1-3H3,(H2,20,21,22) |
| InChIKey | DUBLJOCXBLFFDV-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|