C20H36N6O3 — CID 111409537
1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine (PubChem CID 111409537) has the molecular formula C20H36N6O3 and a molecular weight of 408.55 g/mol. Its IUPAC name is 1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111409537 |
| Molecular Formula | C20H36N6O3 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 1-ethyl-3-[3-(oxolan-2-ylmethoxy)propyl]-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCn1nc2n(c1=O)CCCC2)NCCCOCC1CCCO1 |
| InChI | InChI=1S/C20H36N6O3/c1-2-21-19(23-11-7-14-28-16-17-8-5-15-29-17)22-10-6-13-26-20(27)25-12-4-3-9-18(25)24-26/h17H,2-16H2,1H3,(H2,21,22,23) |
| InChIKey | PKBOVXFZZDAPLT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|