C18H32N6O2 — CID 111189974
1-ethyl-3-(4-hydroxycyclohexyl)-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine (PubChem CID 111189974) has the molecular formula C18H32N6O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-ethyl-3-(4-hydroxycyclohexyl)-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine.
| Compound Name | 1-ethyl-3-(4-hydroxycyclohexyl)-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111189974 |
| Molecular Formula | C18H32N6O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 1-ethyl-3-(4-hydroxycyclohexyl)-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCn1nc2n(c1=O)CCCC2)NC1CCC(O)CC1 |
| InChI | InChI=1S/C18H32N6O2/c1-2-19-17(21-14-7-9-15(25)10-8-14)20-11-5-13-24-18(26)23-12-4-3-6-16(23)22-24/h14-15,25H,2-13H2,1H3,(H2,19,20,21) |
| InChIKey | IJSQWZYXYCARFT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|