C15H28N6O — CID 111125003
1-ethyl-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-propan-2-ylguanidine (PubChem CID 111125003) has the molecular formula C15H28N6O and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-ethyl-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-propan-2-ylguanidine.
| Compound Name | 1-ethyl-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-propan-2-ylguanidine |
|---|---|
| PubChem CID | 111125003 |
| Molecular Formula | C15H28N6O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 1-ethyl-2-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-propan-2-ylguanidine |
| SMILES | CCN/C(=N\CCCn1nc2n(c1=O)CCCC2)NC(C)C |
| InChI | InChI=1S/C15H28N6O/c1-4-16-14(18-12(2)3)17-9-7-11-21-15(22)20-10-6-5-8-13(20)19-21/h12H,4-11H2,1-3H3,(H2,16,17,18) |
| InChIKey | PLAFTIKGAURILW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|